C25H31ClFN7O4 — CID 156897485
5-amino-3-[5-(1-ethyl-3-nitropyrazol-5-yl)-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-1-methylpyrazole-4-carbaldehyde;3-chloro-4-fluoro-N-methylaniline (PubChem CID 156897485) has the molecular formula C25H31ClFN7O4 and a molecular weight of 548.02 g/mol. Its IUPAC name is 5-amino-3-[5-(1-ethyl-3-nitropyrazol-5-yl)-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-1-methylpyrazole-4-carbaldehyde;3-chloro-4-fluoro-N-methylaniline.
| Compound Name | 5-amino-3-[5-(1-ethyl-3-nitropyrazol-5-yl)-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-1-methylpyrazole-4-carbaldehyde;3-chloro-4-fluoro-N-methylaniline |
|---|---|
| PubChem CID | 156897485 |
| Molecular Formula | C25H31ClFN7O4 |
| Molecular Weight | 548.02 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | 5-amino-3-[5-(1-ethyl-3-nitropyrazol-5-yl)-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-1-methylpyrazole-4-carbaldehyde;3-chloro-4-fluoro-N-methylaniline |
| SMILES | CCn1nc([N+](=O)[O-])cc1C1(O)CC2CC(c3nn(C)c(N)c3C=O)CC2C1.CNc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H24N6O4.C7H7ClFN/c1-3-23-14(6-15(20-23)24(27)28)18(26)7-11-4-10(5-12(11)8-18)16-13(9-25)17(19)22(2)21-16;1-10-5-2-3-7(9)6(8)4-5/h6,9-12,26H,3-5,7-8,19H2,1-2H3;2-4,10H,1H3 |
| InChIKey | WAMCGPPLYKTUCD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 154.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.02 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|