C25H29ClF4N6O2 — CID 156897428
5-amino-3-[5-hydroxy-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-1-methylpyrazole-4-carbaldehyde;3-chloro-4-fluoro-N-methylaniline (PubChem CID 156897428) has the molecular formula C25H29ClF4N6O2 and a molecular weight of 556.99 g/mol. Its IUPAC name is 5-amino-3-[5-hydroxy-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-1-methylpyrazole-4-carbaldehyde;3-chloro-4-fluoro-N-methylaniline.
| Compound Name | 5-amino-3-[5-hydroxy-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-1-methylpyrazole-4-carbaldehyde;3-chloro-4-fluoro-N-methylaniline |
|---|---|
| PubChem CID | 156897428 |
| Molecular Formula | C25H29ClF4N6O2 |
| Molecular Weight | 556.99 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | 5-amino-3-[5-hydroxy-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-1-methylpyrazole-4-carbaldehyde;3-chloro-4-fluoro-N-methylaniline |
| SMILES | CNc1ccc(F)c(Cl)c1.Cn1nc(C(F)(F)F)cc1C1(O)CC2CC(c3nn(C)c(N)c3C=O)CC2C1 |
| InChI | InChI=1S/C18H22F3N5O2.C7H7ClFN/c1-25-14(5-13(23-25)18(19,20)21)17(28)6-10-3-9(4-11(10)7-17)15-12(8-27)16(22)26(2)24-15;1-10-5-2-3-7(9)6(8)4-5/h5,8-11,28H,3-4,6-7,22H2,1-2H3;2-4,10H,1H3 |
| InChIKey | WDLLUHZZSLNTOR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 110.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.99 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|