C26H27ClF3N5O3S — CID 166810222
5-amino-N-(3-chloro-4-fluorophenyl)-3-[5-[[(2,4-difluorophenyl)sulfonylamino]methyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-1-methylpyrazole-4-carboxamide (PubChem CID 166810222) has the molecular formula C26H27ClF3N5O3S and a molecular weight of 582.05 g/mol. Its IUPAC name is 5-amino-N-(3-chloro-4-fluorophenyl)-3-[5-[[(2,4-difluorophenyl)sulfonylamino]methyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-1-methylpyrazole-4-carboxamide.
| Compound Name | 5-amino-N-(3-chloro-4-fluorophenyl)-3-[5-[[(2,4-difluorophenyl)sulfonylamino]methyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166810222 |
| Molecular Formula | C26H27ClF3N5O3S |
| Molecular Weight | 582.05 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | 5-amino-N-(3-chloro-4-fluorophenyl)-3-[5-[[(2,4-difluorophenyl)sulfonylamino]methyl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1nc(C2CC3CC(CNS(=O)(=O)c4ccc(F)cc4F)CC3C2)c(C(=O)Nc2ccc(F)c(Cl)c2)c1N |
| InChI | InChI=1S/C26H27ClF3N5O3S/c1-35-25(31)23(26(36)33-18-3-4-20(29)19(27)11-18)24(34-35)16-8-14-6-13(7-15(14)9-16)12-32-39(37,38)22-5-2-17(28)10-21(22)30/h2-5,10-11,13-16,32H,6-9,12,31H2,1H3,(H,33,36) |
| InChIKey | GJYRDKQRNLVILQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.05 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |