C26H32ClFN6O3 — CID 156897335
N-[[5-[5-amino-4-[(3-chloro-4-fluorophenyl)carbamoyl]-1-methylpyrazol-3-yl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]methyl]-2-oxopiperidine-4-carboxamide (PubChem CID 156897335) has the molecular formula C26H32ClFN6O3 and a molecular weight of 531.03 g/mol. Its IUPAC name is N-[[5-[5-amino-4-[(3-chloro-4-fluorophenyl)carbamoyl]-1-methylpyrazol-3-yl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]methyl]-2-oxopiperidine-4-carboxamide.
| Compound Name | N-[[5-[5-amino-4-[(3-chloro-4-fluorophenyl)carbamoyl]-1-methylpyrazol-3-yl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]methyl]-2-oxopiperidine-4-carboxamide |
|---|---|
| PubChem CID | 156897335 |
| Molecular Formula | C26H32ClFN6O3 |
| Molecular Weight | 531.03 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | N-[[5-[5-amino-4-[(3-chloro-4-fluorophenyl)carbamoyl]-1-methylpyrazol-3-yl]-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]methyl]-2-oxopiperidine-4-carboxamide |
| SMILES | Cn1nc(C2CC3CC(CNC(=O)C4CCNC(=O)C4)CC3C2)c(C(=O)Nc2ccc(F)c(Cl)c2)c1N |
| InChI | InChI=1S/C26H32ClFN6O3/c1-34-24(29)22(26(37)32-18-2-3-20(28)19(27)11-18)23(33-34)17-8-15-6-13(7-16(15)9-17)12-31-25(36)14-4-5-30-21(35)10-14/h2-3,11,13-17H,4-10,12,29H2,1H3,(H,30,35)(H,31,36)(H,32,37) |
| InChIKey | OYXJXUMZKIZGAS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 131.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.03 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |