C14H15NO4 — CID 166811070
2-(4-methyl-2,5-dioxo-1,3-oxazolidin-3-yl)-4-phenylbutanal (PubChem CID 166811070) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-(4-methyl-2,5-dioxo-1,3-oxazolidin-3-yl)-4-phenylbutanal.
| Compound Name | 2-(4-methyl-2,5-dioxo-1,3-oxazolidin-3-yl)-4-phenylbutanal |
|---|---|
| PubChem CID | 166811070 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-(4-methyl-2,5-dioxo-1,3-oxazolidin-3-yl)-4-phenylbutanal |
| SMILES | CC1C(=O)OC(=O)N1C(C=O)CCc1ccccc1 |
| InChI | InChI=1S/C14H15NO4/c1-10-13(17)19-14(18)15(10)12(9-16)8-7-11-5-3-2-4-6-11/h2-6,9-10,12H,7-8H2,1H3 |
| InChIKey | QBZBXGSWJDEQOT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|