C18H33NO3 — CID 166813009
(5,5-dimethyl-4-propylheptan-2-yl) 1-formylpyrrolidine-2-carboxylate (PubChem CID 166813009) has the molecular formula C18H33NO3 and a molecular weight of 311.47 g/mol. Its IUPAC name is (5,5-dimethyl-4-propylheptan-2-yl) 1-formylpyrrolidine-2-carboxylate.
| Compound Name | (5,5-dimethyl-4-propylheptan-2-yl) 1-formylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 166813009 |
| Molecular Formula | C18H33NO3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | (5,5-dimethyl-4-propylheptan-2-yl) 1-formylpyrrolidine-2-carboxylate |
| SMILES | CCCC(CC(C)OC(=O)C1CCCN1C=O)C(C)(C)CC |
| InChI | InChI=1S/C18H33NO3/c1-6-9-15(18(4,5)7-2)12-14(3)22-17(21)16-10-8-11-19(16)13-20/h13-16H,6-12H2,1-5H3 |
| InChIKey | WOUKGXPLTSVWRH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|