C12H8Cl5NO3 — CID 165349519
(2,3,4,5,6-pentachlorophenyl) (2S)-1-formylpyrrolidine-2-carboxylate (PubChem CID 165349519) has the molecular formula C12H8Cl5NO3 and a molecular weight of 391.47 g/mol. Its IUPAC name is (2,3,4,5,6-pentachlorophenyl) (2S)-1-formylpyrrolidine-2-carboxylate.
| Compound Name | (2,3,4,5,6-pentachlorophenyl) (2S)-1-formylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 165349519 |
| Molecular Formula | C12H8Cl5NO3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 388.89 |
| IUPAC Name | (2,3,4,5,6-pentachlorophenyl) (2S)-1-formylpyrrolidine-2-carboxylate |
| SMILES | O=CN1CCC[C@H]1C(=O)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H8Cl5NO3/c13-6-7(14)9(16)11(10(17)8(6)15)21-12(20)5-2-1-3-18(5)4-19/h4-5H,1-3H2/t5-/m0/s1 |
| InChIKey | CVJIXCVELCCKCX-YFKPBYRVSA-N |
| XLogP | 4.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|