C29H33Cl2N3O2 — CID 166816461
1-[3-[[5-chloro-4-(4-chloro-3-hydroxyphenyl)-2-[[(1E,3Z,5E)-2,7-dimethylocta-1,3,5-trienyl]amino]anilino]methyl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 166816461) has the molecular formula C29H33Cl2N3O2 and a molecular weight of 526.51 g/mol. Its IUPAC name is 1-[3-[[5-chloro-4-(4-chloro-3-hydroxyphenyl)-2-[[(1E,3Z,5E)-2,7-dimethylocta-1,3,5-trienyl]amino]anilino]methyl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[5-chloro-4-(4-chloro-3-hydroxyphenyl)-2-[[(1E,3Z,5E)-2,7-dimethylocta-1,3,5-trienyl]amino]anilino]methyl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166816461 |
| Molecular Formula | C29H33Cl2N3O2 |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 1-[3-[[5-chloro-4-(4-chloro-3-hydroxyphenyl)-2-[[(1E,3Z,5E)-2,7-dimethylocta-1,3,5-trienyl]amino]anilino]methyl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(CNc2cc(Cl)c(-c3ccc(Cl)c(O)c3)cc2N/C=C(C)/C=C\C=C\C(C)C)C1 |
| InChI | InChI=1S/C29H33Cl2N3O2/c1-5-29(36)34-17-21(18-34)16-33-27-14-25(31)23(22-10-11-24(30)28(35)12-22)13-26(27)32-15-20(4)9-7-6-8-19(2)3/h5-15,19,21,32-33,35H,1,16-18H2,2-4H3/b8-6+,9-7-,20-15+ |
| InChIKey | NLGNKGRIXCQVCQ-VQANHSBGSA-N |
| XLogP | 7.51 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|