C29H30F6N4OS — CID 166818488
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(S)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxy-7,8-dihydroquinolin-4-yl)methyl]thiourea (PubChem CID 166818488) has the molecular formula C29H30F6N4OS and a molecular weight of 596.64 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(S)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxy-7,8-dihydroquinolin-4-yl)methyl]thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(S)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxy-7,8-dihydroquinolin-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 166818488 |
| Molecular Formula | C29H30F6N4OS |
| Molecular Weight | 596.64 g/mol |
| Exact Mass | 596.20 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(S)-[(2S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxy-7,8-dihydroquinolin-4-yl)methyl]thiourea |
| SMILES | C=C[C@H]1CN2CCC1C[C@H]2[C@@H](NC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccnc2c1C=C(OC)CC2 |
| InChI | InChI=1S/C29H30F6N4OS/c1-3-16-15-39-9-7-17(16)10-25(39)26(22-6-8-36-24-5-4-21(40-2)14-23(22)24)38-27(41)37-20-12-18(28(30,31)32)11-19(13-20)29(33,34)35/h3,6,8,11-14,16-17,25-26H,1,4-5,7,9-10,15H2,2H3,(H2,37,38,41)/t16-,17?,25-,26-/m0/s1 |
| InChIKey | VESSNCDPBWJBQP-FSLBOUIOSA-N |
| XLogP | 6.98 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.64 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|