C23H20Cl2N2O4 — CID 166822311
4,6-dichloro-N-[(2,4-dimethoxyphenyl)methyl]-N-(2-methylbenzoyl)pyridine-2-carboxamide (PubChem CID 166822311) has the molecular formula C23H20Cl2N2O4 and a molecular weight of 459.33 g/mol. Its IUPAC name is 4,6-dichloro-N-[(2,4-dimethoxyphenyl)methyl]-N-(2-methylbenzoyl)pyridine-2-carboxamide.
| Compound Name | 4,6-dichloro-N-[(2,4-dimethoxyphenyl)methyl]-N-(2-methylbenzoyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166822311 |
| Molecular Formula | C23H20Cl2N2O4 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 4,6-dichloro-N-[(2,4-dimethoxyphenyl)methyl]-N-(2-methylbenzoyl)pyridine-2-carboxamide |
| SMILES | COc1ccc(CN(C(=O)c2cc(Cl)cc(Cl)n2)C(=O)c2ccccc2C)c(OC)c1 |
| InChI | InChI=1S/C23H20Cl2N2O4/c1-14-6-4-5-7-18(14)22(28)27(23(29)19-10-16(24)11-21(25)26-19)13-15-8-9-17(30-2)12-20(15)31-3/h4-12H,13H2,1-3H3 |
| InChIKey | AZXJUILCBDKKGS-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|