C19H29N3 — CID 16682613
(5S)-1-(4-cyclohexylbutyl)-5-phenyl-4,5-dihydroimidazol-2-amine (PubChem CID 16682613) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is (5S)-1-(4-cyclohexylbutyl)-5-phenyl-4,5-dihydroimidazol-2-amine.
| Compound Name | (5S)-1-(4-cyclohexylbutyl)-5-phenyl-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 16682613 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | (5S)-1-(4-cyclohexylbutyl)-5-phenyl-4,5-dihydroimidazol-2-amine |
| SMILES | NC1=NC[C@H](c2ccccc2)N1CCCCC1CCCCC1 |
| InChI | InChI=1S/C19H29N3/c20-19-21-15-18(17-12-5-2-6-13-17)22(19)14-8-7-11-16-9-3-1-4-10-16/h2,5-6,12-13,16,18H,1,3-4,7-11,14-15H2,(H2,20,21)/t18-/m1/s1 |
| InChIKey | OWCJTQHZMVKDLV-GOSISDBHSA-N |
| XLogP | 4.11 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|