C33H56ClN5O9 — CID 166830197
4-amino-5-chloro-2-methoxy-N-[1-[6-oxo-6-[[8-oxo-8-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]octyl]amino]hexyl]piperidin-4-yl]benzamide (PubChem CID 166830197) has the molecular formula C33H56ClN5O9 and a molecular weight of 702.29 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[1-[6-oxo-6-[[8-oxo-8-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]octyl]amino]hexyl]piperidin-4-yl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[1-[6-oxo-6-[[8-oxo-8-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]octyl]amino]hexyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 166830197 |
| Molecular Formula | C33H56ClN5O9 |
| Molecular Weight | 702.29 g/mol |
| Exact Mass | 701.38 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[1-[6-oxo-6-[[8-oxo-8-[[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]amino]octyl]amino]hexyl]piperidin-4-yl]benzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NC1CCN(CCCCCC(=O)NCCCCCCCC(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)CC1 |
| InChI | InChI=1S/C33H56ClN5O9/c1-48-28-19-25(35)24(34)18-23(28)33(47)38-22-12-16-39(17-13-22)15-9-5-7-10-29(43)36-14-8-4-2-3-6-11-30(44)37-20-26(41)31(45)32(46)27(42)21-40/h18-19,22,26-27,31-32,40-42,45-46H,2-17,20-21,35H2,1H3,(H,36,43)(H,37,44)(H,38,47)/t26-,27+,31+,32+/m0/s1 |
| InChIKey | IEYCOHIYDSSSDA-BZOYJHAOSA-N |
| XLogP | 0.69 |
| TPSA | 226.94 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|