C18H16F3N3O4 — CID 166851152
N-methoxy-5-oxo-N-[1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethyl]hexa-2,3-dienamide (PubChem CID 166851152) has the molecular formula C18H16F3N3O4 and a molecular weight of 395.34 g/mol. Its IUPAC name is N-methoxy-5-oxo-N-[1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethyl]hexa-2,3-dienamide.
| Compound Name | N-methoxy-5-oxo-N-[1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethyl]hexa-2,3-dienamide |
|---|---|
| PubChem CID | 166851152 |
| Molecular Formula | C18H16F3N3O4 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N-methoxy-5-oxo-N-[1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethyl]hexa-2,3-dienamide |
| SMILES | CON(C(=O)C=C=CC(C)=O)C(C)c1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C18H16F3N3O4/c1-11(25)5-4-6-15(26)24(27-3)12(2)13-7-9-14(10-8-13)16-22-17(28-23-16)18(19,20)21/h5-10,12H,1-3H3 |
| InChIKey | WMGCHLFPNGSQDO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|