C18H20F3N3O3 — CID 166851162
(E)-N-methoxy-N-[1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethyl]hex-4-enamide (PubChem CID 166851162) has the molecular formula C18H20F3N3O3 and a molecular weight of 383.37 g/mol. Its IUPAC name is (E)-N-methoxy-N-[1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethyl]hex-4-enamide.
| Compound Name | (E)-N-methoxy-N-[1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethyl]hex-4-enamide |
|---|---|
| PubChem CID | 166851162 |
| Molecular Formula | C18H20F3N3O3 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | (E)-N-methoxy-N-[1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethyl]hex-4-enamide |
| SMILES | C/C=C/CCC(=O)N(OC)C(C)c1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C18H20F3N3O3/c1-4-5-6-7-15(25)24(26-3)12(2)13-8-10-14(11-9-13)16-22-17(27-23-16)18(19,20)21/h4-5,8-12H,6-7H2,1-3H3/b5-4+ |
| InChIKey | BVOXBHKECJAMJW-SNAWJCMRSA-N |
| XLogP | 4.56 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|