C17H16F3N5O3 — CID 146521209
1-[cyano-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-3-methoxy-3-methyl-1-prop-2-enylurea (PubChem CID 146521209) has the molecular formula C17H16F3N5O3 and a molecular weight of 395.34 g/mol. Its IUPAC name is 1-[cyano-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-3-methoxy-3-methyl-1-prop-2-enylurea.
| Compound Name | 1-[cyano-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-3-methoxy-3-methyl-1-prop-2-enylurea |
|---|---|
| PubChem CID | 146521209 |
| Molecular Formula | C17H16F3N5O3 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 1-[cyano-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-3-methoxy-3-methyl-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)N(C)OC)C(C#N)c1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C17H16F3N5O3/c1-4-9-25(16(26)24(2)27-3)13(10-21)11-5-7-12(8-6-11)14-22-15(28-23-14)17(18,19)20/h4-8,13H,1,9H2,2-3H3 |
| InChIKey | ADBOHIWHQALXBU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 95.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|