C17H18ClF4N3O3 — CID 166653752
5-chloro-4-fluoro-N-methoxy-N-[1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethyl]pentanamide (PubChem CID 166653752) has the molecular formula C17H18ClF4N3O3 and a molecular weight of 423.79 g/mol. Its IUPAC name is 5-chloro-4-fluoro-N-methoxy-N-[1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethyl]pentanamide.
| Compound Name | 5-chloro-4-fluoro-N-methoxy-N-[1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethyl]pentanamide |
|---|---|
| PubChem CID | 166653752 |
| Molecular Formula | C17H18ClF4N3O3 |
| Molecular Weight | 423.79 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 5-chloro-4-fluoro-N-methoxy-N-[1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethyl]pentanamide |
| SMILES | CON(C(=O)CCC(F)CCl)C(C)c1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C17H18ClF4N3O3/c1-10(25(27-2)14(26)8-7-13(19)9-18)11-3-5-12(6-4-11)15-23-16(28-24-15)17(20,21)22/h3-6,10,13H,7-9H2,1-2H3 |
| InChIKey | KODOFQGDXZLNBQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.79 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|