C7H11Cl2N — CID 166863609
(2E,4E)-5,6-dichloro-N-methylhexa-2,4-dien-3-amine (PubChem CID 166863609) has the molecular formula C7H11Cl2N and a molecular weight of 180.08 g/mol. Its IUPAC name is (2E,4E)-5,6-dichloro-N-methylhexa-2,4-dien-3-amine.
| Compound Name | (2E,4E)-5,6-dichloro-N-methylhexa-2,4-dien-3-amine |
|---|---|
| PubChem CID | 166863609 |
| Molecular Formula | C7H11Cl2N |
| Molecular Weight | 180.08 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | (2E,4E)-5,6-dichloro-N-methylhexa-2,4-dien-3-amine |
| SMILES | C/C=C(\C=C(\Cl)CCl)NC |
| InChI | InChI=1S/C7H11Cl2N/c1-3-7(10-2)4-6(9)5-8/h3-4,10H,5H2,1-2H3/b6-4+,7-3+ |
| InChIKey | JXGLPRWLQBLWRY-DVFLZCIWSA-N |
| XLogP | 2.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.08 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|