C14H11BiClF3O3S — CID 16688184
[(4-chlorophenyl)-(2-methylphenyl)bismuthanyl] trifluoromethanesulfonate (PubChem CID 16688184) has the molecular formula C14H11BiClF3O3S and a molecular weight of 560.73 g/mol. Its IUPAC name is [(4-chlorophenyl)-(2-methylphenyl)bismuthanyl] trifluoromethanesulfonate.
| Compound Name | [(4-chlorophenyl)-(2-methylphenyl)bismuthanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 16688184 |
| Molecular Formula | C14H11BiClF3O3S |
| Molecular Weight | 560.73 g/mol |
| Exact Mass | 559.99 |
| IUPAC Name | [(4-chlorophenyl)-(2-methylphenyl)bismuthanyl] trifluoromethanesulfonate |
| SMILES | Cc1ccccc1[Bi](OS(=O)(=O)C(F)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C7H7.C6H4Cl.CHF3O3S.Bi/c1-7-5-3-2-4-6-7;7-6-4-2-1-3-5-6;2-1(3,4)8(5,6)7;/h2-5H,1H3;2-5H;(H,5,6,7);/q;;;+1/p-1 |
| InChIKey | PWOZUTLKMBTDTB-UHFFFAOYSA-M |
| XLogP | 2.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.73 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|