C31H38O2 — CID 166881940
(8S,11R,13S,14S,17S)-11-[(2E,4Z)-6-cyclopropylhepta-2,4,6-trien-2-yl]-17-hydroxy-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 166881940) has the molecular formula C31H38O2 and a molecular weight of 442.64 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-11-[(2E,4Z)-6-cyclopropylhepta-2,4,6-trien-2-yl]-17-hydroxy-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-11-[(2E,4Z)-6-cyclopropylhepta-2,4,6-trien-2-yl]-17-hydroxy-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 166881940 |
| Molecular Formula | C31H38O2 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | (8S,11R,13S,14S,17S)-11-[(2E,4Z)-6-cyclopropylhepta-2,4,6-trien-2-yl]-17-hydroxy-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=C(/C=C\C=C(/C)[C@H]1C[C@@]2(C)[C@@H](CC[C@@]2(O)C#CC)[C@@H]2CCC3=CC(=O)CCC3=C21)C1CC1 |
| InChI | InChI=1S/C31H38O2/c1-5-16-31(33)17-15-28-26-13-11-23-18-24(32)12-14-25(23)29(26)27(19-30(28,31)4)21(3)8-6-7-20(2)22-9-10-22/h6-8,18,22,26-28,33H,2,9-15,17,19H2,1,3-4H3/b7-6-,21-8+/t26-,27+,28-,30-,31-/m0/s1 |
| InChIKey | SGBMREFKORSEGY-FHILPQCUSA-N |
| XLogP | 6.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|