C14H24Cl2N4O3 — CID 166888317
tert-butyl 4-[(1Z,3E)-1,4-diamino-1,4-dichlorobuta-1,3-dien-2-yl]-3-(hydroxymethyl)piperazine-1-carboxylate (PubChem CID 166888317) has the molecular formula C14H24Cl2N4O3 and a molecular weight of 367.28 g/mol. Its IUPAC name is tert-butyl 4-[(1Z,3E)-1,4-diamino-1,4-dichlorobuta-1,3-dien-2-yl]-3-(hydroxymethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1Z,3E)-1,4-diamino-1,4-dichlorobuta-1,3-dien-2-yl]-3-(hydroxymethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166888317 |
| Molecular Formula | C14H24Cl2N4O3 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | tert-butyl 4-[(1Z,3E)-1,4-diamino-1,4-dichlorobuta-1,3-dien-2-yl]-3-(hydroxymethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(/C=C(\N)Cl)=C(/N)Cl)C(CO)C1 |
| InChI | InChI=1S/C14H24Cl2N4O3/c1-14(2,3)23-13(22)19-4-5-20(9(7-19)8-21)10(12(16)18)6-11(15)17/h6,9,21H,4-5,7-8,17-18H2,1-3H3/b11-6-,12-10+ |
| InChIKey | BQPIXPPERYBUCA-QVIJUPDLSA-N |
| XLogP | 1.31 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|