About triphenylgermyl N-methyl-N-phenylcarbamodithioate
triphenylgermyl N-methyl-N-phenylcarbamodithioate (PubChem CID 16689609) has the molecular formula C26H23GeNS2
and a molecular weight of 486.22 g/mol. Its IUPAC name is triphenylgermyl N-methyl-N-phenylcarbamodithioate.
Molecular Properties
| Compound Name | triphenylgermyl N-methyl-N-phenylcarbamodithioate |
| PubChem CID | 16689609 |
| Molecular Formula | C26H23GeNS2 |
| Molecular Weight | 486.22 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | triphenylgermyl N-methyl-N-phenylcarbamodithioate |
| SMILES | CN(C(=S)S[Ge](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H23GeNS2/c1-28(25-20-12-5-13-21-25)26(29)30-27(22-14-6-2-7-15-22,23-16-8-3-9-17-23)24-18-10-4-11-19-24/h2-21H,1H3 |
| InChIKey | XXUXWMBJMVFDHQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.22 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze triphenylgermyl N-methyl-N-phenylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenylgermyl N-methyl-N-phenylcarbamodithioate?
The IUPAC name of triphenylgermyl N-methyl-N-phenylcarbamodithioate (CID 16689609) is triphenylgermyl N-methyl-N-phenylcarbamodithioate.
What is the SMILES notation for triphenylgermyl N-methyl-N-phenylcarbamodithioate?
The canonical SMILES for triphenylgermyl N-methyl-N-phenylcarbamodithioate is CN(C(=S)S[Ge](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of triphenylgermyl N-methyl-N-phenylcarbamodithioate?
The InChIKey is XXUXWMBJMVFDHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23GeNS2/c1-28(25-20-12-5-13-21-25)26(29)30-27(22-14-6-2-7-15-22,23-16-8-3-9-17-23)24-18-10-4-11-19-24/h2-21H,1H3.
What are the key properties of triphenylgermyl N-methyl-N-phenylcarbamodithioate?
triphenylgermyl N-methyl-N-phenylcarbamodithioate has a molecular weight of 486.22 g/mol, XLogP of 4.81, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for triphenylgermyl N-methyl-N-phenylcarbamodithioate is sourced from PubChem (CID 16689609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).