C12H14N2 — CID 166896380
4-methyl-2-propan-2-yl-1,5-naphthyridine (PubChem CID 166896380) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 4-methyl-2-propan-2-yl-1,5-naphthyridine.
| Compound Name | 4-methyl-2-propan-2-yl-1,5-naphthyridine |
|---|---|
| PubChem CID | 166896380 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 4-methyl-2-propan-2-yl-1,5-naphthyridine |
| SMILES | Cc1cc(C(C)C)nc2cccnc12 |
| InChI | InChI=1S/C12H14N2/c1-8(2)11-7-9(3)12-10(14-11)5-4-6-13-12/h4-8H,1-3H3 |
| InChIKey | BKWMDCRYYGHRGA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |