C10H14N2O3 — CID 166899485
tert-butyl 5-imino-3-methyl-2-oxopyrrole-1-carboxylate (PubChem CID 166899485) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is tert-butyl 5-imino-3-methyl-2-oxopyrrole-1-carboxylate.
| Compound Name | tert-butyl 5-imino-3-methyl-2-oxopyrrole-1-carboxylate |
|---|---|
| PubChem CID | 166899485 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | tert-butyl 5-imino-3-methyl-2-oxopyrrole-1-carboxylate |
| SMILES | [H]/N=C1\C=C(C)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H14N2O3/c1-6-5-7(11)12(8(6)13)9(14)15-10(2,3)4/h5,11H,1-4H3/b11-7+ |
| InChIKey | HUTJBDGRDZUTPQ-YRNVUSSQSA-N |
| XLogP | 1.69 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|