C14H15N3O4 — CID 141464957
tert-butyl 4-diazo-5-methyl-2,3-dioxo-3aH-indole-1-carboxylate (PubChem CID 141464957) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is tert-butyl 4-diazo-5-methyl-2,3-dioxo-3aH-indole-1-carboxylate.
| Compound Name | tert-butyl 4-diazo-5-methyl-2,3-dioxo-3aH-indole-1-carboxylate |
|---|---|
| PubChem CID | 141464957 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | tert-butyl 4-diazo-5-methyl-2,3-dioxo-3aH-indole-1-carboxylate |
| SMILES | CC1=CC=C2C(C(=O)C(=O)N2C(=O)OC(C)(C)C)C1=[N+]=[N-] |
| InChI | InChI=1S/C14H15N3O4/c1-7-5-6-8-9(10(7)16-15)11(18)12(19)17(8)13(20)21-14(2,3)4/h5-6,9H,1-4H3 |
| InChIKey | UFIZBRGJXADOBH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 100.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|