C16H26N2O7 — CID 166903543
N-(2,6-dioxohexan-3-yl)-4-[(2-hydroxy-3-methoxypropanoyl)amino]-5-oxohexanamide (PubChem CID 166903543) has the molecular formula C16H26N2O7 and a molecular weight of 358.39 g/mol. Its IUPAC name is N-(2,6-dioxohexan-3-yl)-4-[(2-hydroxy-3-methoxypropanoyl)amino]-5-oxohexanamide.
| Compound Name | N-(2,6-dioxohexan-3-yl)-4-[(2-hydroxy-3-methoxypropanoyl)amino]-5-oxohexanamide |
|---|---|
| PubChem CID | 166903543 |
| Molecular Formula | C16H26N2O7 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-(2,6-dioxohexan-3-yl)-4-[(2-hydroxy-3-methoxypropanoyl)amino]-5-oxohexanamide |
| SMILES | COCC(O)C(=O)NC(CCC(=O)NC(CCC=O)C(C)=O)C(C)=O |
| InChI | InChI=1S/C16H26N2O7/c1-10(20)12(5-4-8-19)17-15(23)7-6-13(11(2)21)18-16(24)14(22)9-25-3/h8,12-14,22H,4-7,9H2,1-3H3,(H,17,23)(H,18,24) |
| InChIKey | MBRDYCZDURBFFQ-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|