C12H22N2O3S — CID 166964447
N-(2,6-dioxohexan-3-yl)-6-(sulfanylamino)hexanamide (PubChem CID 166964447) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is N-(2,6-dioxohexan-3-yl)-6-(sulfanylamino)hexanamide.
| Compound Name | N-(2,6-dioxohexan-3-yl)-6-(sulfanylamino)hexanamide |
|---|---|
| PubChem CID | 166964447 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N-(2,6-dioxohexan-3-yl)-6-(sulfanylamino)hexanamide |
| SMILES | CC(=O)C(CCC=O)NC(=O)CCCCCNS |
| InChI | InChI=1S/C12H22N2O3S/c1-10(16)11(6-5-9-15)14-12(17)7-3-2-4-8-13-18/h9,11,13,18H,2-8H2,1H3,(H,14,17) |
| InChIKey | UGSHRLQWMIUKOG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|