C13H21F2N — CID 166907556
1,1-difluoro-N-[(E)-2-methylhex-1-enyl]hex-3-en-2-imine (PubChem CID 166907556) has the molecular formula C13H21F2N and a molecular weight of 229.31 g/mol. Its IUPAC name is 1,1-difluoro-N-[(E)-2-methylhex-1-enyl]hex-3-en-2-imine.
| Compound Name | 1,1-difluoro-N-[(E)-2-methylhex-1-enyl]hex-3-en-2-imine |
|---|---|
| PubChem CID | 166907556 |
| Molecular Formula | C13H21F2N |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 1,1-difluoro-N-[(E)-2-methylhex-1-enyl]hex-3-en-2-imine |
| SMILES | CCC=C/C(=N\C=C(/C)CCCC)C(F)F |
| InChI | InChI=1S/C13H21F2N/c1-4-6-8-11(3)10-16-12(13(14)15)9-7-5-2/h7,9-10,13H,4-6,8H2,1-3H3/b9-7?,11-10+,16-12+ |
| InChIKey | SVVCUPWWHGRWAV-UWJUABAVSA-N |
| XLogP | 4.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|