C31H44N2O6 — CID 166922087
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-[ethyl-[2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]pent-4-enoyl]amino]butanoate (PubChem CID 166922087) has the molecular formula C31H44N2O6 and a molecular weight of 540.70 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-[ethyl-[2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]pent-4-enoyl]amino]butanoate.
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-[ethyl-[2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]pent-4-enoyl]amino]butanoate |
|---|---|
| PubChem CID | 166922087 |
| Molecular Formula | C31H44N2O6 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.32 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-[ethyl-[2-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino]pent-4-enoyl]amino]butanoate |
| SMILES | C=CCC(NC(=O)/C=C/c1ccc(O)c(OC)c1)C(=O)N(CC)C(CC)C(=O)OC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C31H44N2O6/c1-8-11-22(32-27(35)15-13-20-12-14-24(34)25(18-20)38-7)28(36)33(10-3)23(9-2)29(37)39-26-19-21-16-17-31(26,6)30(21,4)5/h8,12-15,18,21-23,26,34H,1,9-11,16-17,19H2,2-7H3,(H,32,35)/b15-13+ |
| InChIKey | WJJMULIXRIFISG-FYWRMAATSA-N |
| XLogP | 4.86 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|