C15H16F2N2O3 — CID 166925619
(5S)-3-[3,5-difluoro-4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)phenyl]-5-methyl-1,3-oxazolidin-2-one (PubChem CID 166925619) has the molecular formula C15H16F2N2O3 and a molecular weight of 310.30 g/mol. Its IUPAC name is (5S)-3-[3,5-difluoro-4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)phenyl]-5-methyl-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[3,5-difluoro-4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)phenyl]-5-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 166925619 |
| Molecular Formula | C15H16F2N2O3 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (5S)-3-[3,5-difluoro-4-(2-oxa-6-azaspiro[3.3]heptan-6-yl)phenyl]-5-methyl-1,3-oxazolidin-2-one |
| SMILES | C[C@H]1CN(c2cc(F)c(N3CC4(COC4)C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C15H16F2N2O3/c1-9-4-19(14(20)22-9)10-2-11(16)13(12(17)3-10)18-5-15(6-18)7-21-8-15/h2-3,9H,4-8H2,1H3/t9-/m0/s1 |
| InChIKey | RHMXSFPZOMWPJS-VIFPVBQESA-N |
| XLogP | 2.15 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|