C29H42O — CID 166930372
2-[(1E,3E,5E,7E,9E,11E,13E)-15-ethoxy-3,7,12-trimethylpentadeca-1,3,5,7,9,11,13-heptaenyl]-1,3,3-trimethylcyclohexene (PubChem CID 166930372) has the molecular formula C29H42O and a molecular weight of 406.65 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7E,9E,11E,13E)-15-ethoxy-3,7,12-trimethylpentadeca-1,3,5,7,9,11,13-heptaenyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(1E,3E,5E,7E,9E,11E,13E)-15-ethoxy-3,7,12-trimethylpentadeca-1,3,5,7,9,11,13-heptaenyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 166930372 |
| Molecular Formula | C29H42O |
| Molecular Weight | 406.65 g/mol |
| Exact Mass | 406.32 |
| IUPAC Name | 2-[(1E,3E,5E,7E,9E,11E,13E)-15-ethoxy-3,7,12-trimethylpentadeca-1,3,5,7,9,11,13-heptaenyl]-1,3,3-trimethylcyclohexene |
| SMILES | CCOC/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C29H42O/c1-8-30-23-13-18-25(3)15-10-9-14-24(2)16-11-17-26(4)20-21-28-27(5)19-12-22-29(28,6)7/h9-11,13-18,20-21H,8,12,19,22-23H2,1-7H3/b10-9+,16-11+,18-13+,21-20+,24-14+,25-15+,26-17+ |
| InChIKey | FZMMENBUIQBONO-VUTDLPDZSA-N |
| XLogP | 8.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.65 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|