C26H46N2O8S2 — CID 166931257
(2,5-dioxopyrrolidin-1-yl) 3-[1-[(2-methyl-4-propan-2-yloxybutan-2-yl)carbamoyloxy]hexan-3-yldisulfanyl]hexyl carbonate (PubChem CID 166931257) has the molecular formula C26H46N2O8S2 and a molecular weight of 578.79 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[1-[(2-methyl-4-propan-2-yloxybutan-2-yl)carbamoyloxy]hexan-3-yldisulfanyl]hexyl carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[1-[(2-methyl-4-propan-2-yloxybutan-2-yl)carbamoyloxy]hexan-3-yldisulfanyl]hexyl carbonate |
|---|---|
| PubChem CID | 166931257 |
| Molecular Formula | C26H46N2O8S2 |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[1-[(2-methyl-4-propan-2-yloxybutan-2-yl)carbamoyloxy]hexan-3-yldisulfanyl]hexyl carbonate |
| SMILES | CCCC(CCOC(=O)NC(C)(C)CCOC(C)C)SSC(CCC)CCOC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C26H46N2O8S2/c1-7-9-20(13-16-34-24(31)27-26(5,6)15-18-33-19(3)4)37-38-21(10-8-2)14-17-35-25(32)36-28-22(29)11-12-23(28)30/h19-21H,7-18H2,1-6H3,(H,27,31) |
| InChIKey | SRAQOLLWJWUDGY-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|