C21H37NO7 — CID 130268057
(2,5-dioxopyrrolidin-1-yl) [2-[1-(3-methoxy-3-methylpentoxy)ethyl]-4-methylhexyl] carbonate (PubChem CID 130268057) has the molecular formula C21H37NO7 and a molecular weight of 415.53 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) [2-[1-(3-methoxy-3-methylpentoxy)ethyl]-4-methylhexyl] carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) [2-[1-(3-methoxy-3-methylpentoxy)ethyl]-4-methylhexyl] carbonate |
|---|---|
| PubChem CID | 130268057 |
| Molecular Formula | C21H37NO7 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) [2-[1-(3-methoxy-3-methylpentoxy)ethyl]-4-methylhexyl] carbonate |
| SMILES | CCC(C)CC(COC(=O)ON1C(=O)CCC1=O)C(C)OCCC(C)(CC)OC |
| InChI | InChI=1S/C21H37NO7/c1-7-15(3)13-17(16(4)27-12-11-21(5,8-2)26-6)14-28-20(25)29-22-18(23)9-10-19(22)24/h15-17H,7-14H2,1-6H3 |
| InChIKey | LDMJAFSYKRBPOB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|