C36H44F6N2O6 — CID 166947132
CID 166947132 (PubChem CID 166947132) has the molecular formula C36H44F6N2O6 and a molecular weight of 714.74 g/mol.
| Compound Name | CID 166947132 |
|---|---|
| PubChem CID | 166947132 |
| Molecular Formula | C36H44F6N2O6 |
| Molecular Weight | 714.74 g/mol |
| Exact Mass | 714.31 |
| IUPAC Name | — |
| SMILES | CCC1CC2CC(C)CC(C2)C12OOC1(CCCC(OC(=O)N3CCCCC3[C@@H](O)c3cc(C(F)(F)F)nc4c(C(F)(F)F)cccc34)C1)O2 |
| InChI | InChI=1S/C36H44F6N2O6/c1-3-22-16-21-14-20(2)15-23(17-21)34(22)48-33(49-50-34)12-7-8-24(19-33)47-32(46)44-13-5-4-11-28(44)31(45)26-18-29(36(40,41)42)43-30-25(26)9-6-10-27(30)35(37,38)39/h6,9-10,18,20-24,28,31,45H,3-5,7-8,11-17,19H2,1-2H3/t20?,21?,22?,23?,24?,28?,31-,33?,34?/m0/s1 |
| InChIKey | AFCONOYPKSMRET-DHAXCHBWSA-N |
| XLogP | 9.09 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.74 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|