C32H36F6N2O6 — CID 176589503
CID 176589503 (PubChem CID 176589503) has the molecular formula C32H36F6N2O6 and a molecular weight of 658.64 g/mol.
| Compound Name | CID 176589503 |
|---|---|
| PubChem CID | 176589503 |
| Molecular Formula | C32H36F6N2O6 |
| Molecular Weight | 658.64 g/mol |
| Exact Mass | 658.25 |
| IUPAC Name | — |
| SMILES | O=C(O[C@@H]1CCC[C@]2(C1)OOC1(CC3CCC1CC3)O2)N1CCCCC1C(O)c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C32H36F6N2O6/c33-31(34,35)23-7-3-6-21-22(15-25(32(36,37)38)39-26(21)23)27(41)24-8-1-2-14-40(24)28(42)43-20-5-4-13-29(17-20)44-30(46-45-29)16-18-9-11-19(30)12-10-18/h3,6-7,15,18-20,24,27,41H,1-2,4-5,8-14,16-17H2/t18?,19?,20-,24?,27?,29-,30?/m1/s1 |
| InChIKey | BKYULQANCNCNGQ-GNFZWZINSA-N |
| XLogP | 7.82 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.64 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|