C11H9ClN4O3 — CID 166951785
5-(7-chloro-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-3-yl)-1,4-dihydropyrazine-2,3-dione (PubChem CID 166951785) has the molecular formula C11H9ClN4O3 and a molecular weight of 280.67 g/mol. Its IUPAC name is 5-(7-chloro-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-3-yl)-1,4-dihydropyrazine-2,3-dione.
| Compound Name | 5-(7-chloro-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-3-yl)-1,4-dihydropyrazine-2,3-dione |
|---|---|
| PubChem CID | 166951785 |
| Molecular Formula | C11H9ClN4O3 |
| Molecular Weight | 280.67 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 5-(7-chloro-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazin-3-yl)-1,4-dihydropyrazine-2,3-dione |
| SMILES | O=c1[nH]cc(C2COc3cc(Cl)cnc3N2)[nH]c1=O |
| InChI | InChI=1S/C11H9ClN4O3/c12-5-1-8-9(13-2-5)15-7(4-19-8)6-3-14-10(17)11(18)16-6/h1-3,7H,4H2,(H,13,15)(H,14,17)(H,16,18) |
| InChIKey | KLGZAVQERKBIRA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.67 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|