C12H16ClN7O4S — CID 166960864
N-(3-chloro-5-sulfamoylcyclohexyl)-3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide (PubChem CID 166960864) has the molecular formula C12H16ClN7O4S and a molecular weight of 389.83 g/mol. Its IUPAC name is N-(3-chloro-5-sulfamoylcyclohexyl)-3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide.
| Compound Name | N-(3-chloro-5-sulfamoylcyclohexyl)-3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
|---|---|
| PubChem CID | 166960864 |
| Molecular Formula | C12H16ClN7O4S |
| Molecular Weight | 389.83 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | N-(3-chloro-5-sulfamoylcyclohexyl)-3-methyl-4-oxoimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxamide |
| SMILES | Cn1nnc2c(C(=O)NC3CC(Cl)CC(S(N)(=O)=O)C3)ncn2c1=O |
| InChI | InChI=1S/C12H16ClN7O4S/c1-19-12(22)20-5-15-9(10(20)17-18-19)11(21)16-7-2-6(13)3-8(4-7)25(14,23)24/h5-8H,2-4H2,1H3,(H,16,21)(H2,14,23,24) |
| InChIKey | OCHRRDKLKRZJGZ-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 154.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.83 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|