C26H27F3N2O6S — CID 166972835
ethyl 4-[4-cyano-2-[[2-[(1R)-1-methyl-6-(trifluoromethylsulfonyloxy)-2,3-dihydroinden-1-yl]acetyl]amino]phenyl]butanoate (PubChem CID 166972835) has the molecular formula C26H27F3N2O6S and a molecular weight of 552.57 g/mol. Its IUPAC name is ethyl 4-[4-cyano-2-[[2-[(1R)-1-methyl-6-(trifluoromethylsulfonyloxy)-2,3-dihydroinden-1-yl]acetyl]amino]phenyl]butanoate.
| Compound Name | ethyl 4-[4-cyano-2-[[2-[(1R)-1-methyl-6-(trifluoromethylsulfonyloxy)-2,3-dihydroinden-1-yl]acetyl]amino]phenyl]butanoate |
|---|---|
| PubChem CID | 166972835 |
| Molecular Formula | C26H27F3N2O6S |
| Molecular Weight | 552.57 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | ethyl 4-[4-cyano-2-[[2-[(1R)-1-methyl-6-(trifluoromethylsulfonyloxy)-2,3-dihydroinden-1-yl]acetyl]amino]phenyl]butanoate |
| SMILES | CCOC(=O)CCCc1ccc(C#N)cc1NC(=O)C[C@@]1(C)CCc2ccc(OS(=O)(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C26H27F3N2O6S/c1-3-36-24(33)6-4-5-19-8-7-17(16-30)13-22(19)31-23(32)15-25(2)12-11-18-9-10-20(14-21(18)25)37-38(34,35)26(27,28)29/h7-10,13-14H,3-6,11-12,15H2,1-2H3,(H,31,32)/t25-/m1/s1 |
| InChIKey | CRWMOOSJZOUZRE-RUZDIDTESA-N |
| XLogP | 4.91 |
| TPSA | 122.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|