C26H38N4O8S — CID 166980101
(4R)-4-amino-2-[N-[3-[2-(2-methoxyethoxy)ethoxy]-2-oxopropyl]-C-methylcarbonimidoyl]-N-[(1R)-1-(6-oxo-4-prop-2-enoxypyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide (PubChem CID 166980101) has the molecular formula C26H38N4O8S and a molecular weight of 566.68 g/mol. Its IUPAC name is (4R)-4-amino-2-[N-[3-[2-(2-methoxyethoxy)ethoxy]-2-oxopropyl]-C-methylcarbonimidoyl]-N-[(1R)-1-(6-oxo-4-prop-2-enoxypyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide.
| Compound Name | (4R)-4-amino-2-[N-[3-[2-(2-methoxyethoxy)ethoxy]-2-oxopropyl]-C-methylcarbonimidoyl]-N-[(1R)-1-(6-oxo-4-prop-2-enoxypyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 166980101 |
| Molecular Formula | C26H38N4O8S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | (4R)-4-amino-2-[N-[3-[2-(2-methoxyethoxy)ethoxy]-2-oxopropyl]-C-methylcarbonimidoyl]-N-[(1R)-1-(6-oxo-4-prop-2-enoxypyran-2-yl)butyl]-5H-1,3-thiazole-4-carboxamide |
| SMILES | C=CCOc1cc([C@@H](CCC)NC(=O)[C@]2(N)CSC(/C(C)=N/CC(=O)COCCOCCOC)=N2)oc(=O)c1 |
| InChI | InChI=1S/C26H38N4O8S/c1-5-7-21(22-13-20(37-8-6-2)14-23(32)38-22)29-25(33)26(27)17-39-24(30-26)18(3)28-15-19(31)16-36-12-11-35-10-9-34-4/h6,13-14,21H,2,5,7-12,15-17,27H2,1,3-4H3,(H,29,33)/b28-18+/t21-,26+/m1/s1 |
| InChIKey | DRTDYKLGVXYNFD-AOWRLFJDSA-N |
| XLogP | 1.67 |
| TPSA | 164.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|