C17H20F3N3O3S — CID 166981869
2-(tert-butylsulfonylamino)-N-(3-cyanobut-3-enyl)-5-(trifluoromethyl)benzamide (PubChem CID 166981869) has the molecular formula C17H20F3N3O3S and a molecular weight of 403.43 g/mol. Its IUPAC name is 2-(tert-butylsulfonylamino)-N-(3-cyanobut-3-enyl)-5-(trifluoromethyl)benzamide.
| Compound Name | 2-(tert-butylsulfonylamino)-N-(3-cyanobut-3-enyl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 166981869 |
| Molecular Formula | C17H20F3N3O3S |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 2-(tert-butylsulfonylamino)-N-(3-cyanobut-3-enyl)-5-(trifluoromethyl)benzamide |
| SMILES | C=C(C#N)CCNC(=O)c1cc(C(F)(F)F)ccc1NS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C17H20F3N3O3S/c1-11(10-21)7-8-22-15(24)13-9-12(17(18,19)20)5-6-14(13)23-27(25,26)16(2,3)4/h5-6,9,23H,1,7-8H2,2-4H3,(H,22,24) |
| InChIKey | ISUIWLKHYDHBKJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|