C13H15F3N2O3S — CID 166770510
N-but-3-enyl-2-(methanesulfonamido)-5-(trifluoromethyl)benzamide (PubChem CID 166770510) has the molecular formula C13H15F3N2O3S and a molecular weight of 336.34 g/mol. Its IUPAC name is N-but-3-enyl-2-(methanesulfonamido)-5-(trifluoromethyl)benzamide.
| Compound Name | N-but-3-enyl-2-(methanesulfonamido)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 166770510 |
| Molecular Formula | C13H15F3N2O3S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | N-but-3-enyl-2-(methanesulfonamido)-5-(trifluoromethyl)benzamide |
| SMILES | C=CCCNC(=O)c1cc(C(F)(F)F)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C13H15F3N2O3S/c1-3-4-7-17-12(19)10-8-9(13(14,15)16)5-6-11(10)18-22(2,20)21/h3,5-6,8,18H,1,4,7H2,2H3,(H,17,19) |
| InChIKey | MMEMLRPZQPWKBK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|