About N-[(2E)-2-ethenylpenta-2,4-dienylidene]-N'-methanimidoylbenzenecarboximidamide
N-[(2E)-2-ethenylpenta-2,4-dienylidene]-N'-methanimidoylbenzenecarboximidamide (PubChem CID 166984457) has the molecular formula C15H15N3
and a molecular weight of 237.31 g/mol. Its IUPAC name is N-[(2E)-2-ethenylpenta-2,4-dienylidene]-N'-methanimidoylbenzenecarboximidamide.
Molecular Properties
| Compound Name | N-[(2E)-2-ethenylpenta-2,4-dienylidene]-N'-methanimidoylbenzenecarboximidamide |
| PubChem CID | 166984457 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | N-[(2E)-2-ethenylpenta-2,4-dienylidene]-N'-methanimidoylbenzenecarboximidamide |
| SMILES | [H]/N=C/N=C(\N=C\C(C=C)=C\C=C)c1ccccc1 |
| InChI | InChI=1S/C15H15N3/c1-3-8-13(4-2)11-17-15(18-12-16)14-9-6-5-7-10-14/h3-12,16H,1-2H2/b13-8+,16-12+,17-11+,18-15- |
| InChIKey | FPYXAKATBWQPPK-HRWHOCDTSA-N |
| XLogP | 3.41 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E)-2-ethenylpenta-2,4-dienylidene]-N'-methanimidoylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E)-2-ethenylpenta-2,4-dienylidene]-N'-methanimidoylbenzenecarboximidamide?
The IUPAC name of N-[(2E)-2-ethenylpenta-2,4-dienylidene]-N'-methanimidoylbenzenecarboximidamide (CID 166984457) is N-[(2E)-2-ethenylpenta-2,4-dienylidene]-N'-methanimidoylbenzenecarboximidamide.
What is the SMILES notation for N-[(2E)-2-ethenylpenta-2,4-dienylidene]-N'-methanimidoylbenzenecarboximidamide?
The canonical SMILES for N-[(2E)-2-ethenylpenta-2,4-dienylidene]-N'-methanimidoylbenzenecarboximidamide is [H]/N=C/N=C(\N=C\C(C=C)=C\C=C)c1ccccc1.
What is the InChIKey of N-[(2E)-2-ethenylpenta-2,4-dienylidene]-N'-methanimidoylbenzenecarboximidamide?
The InChIKey is FPYXAKATBWQPPK-HRWHOCDTSA-N. The full InChI is InChI=1S/C15H15N3/c1-3-8-13(4-2)11-17-15(18-12-16)14-9-6-5-7-10-14/h3-12,16H,1-2H2/b13-8+,16-12+,17-11+,18-15-.
What are the key properties of N-[(2E)-2-ethenylpenta-2,4-dienylidene]-N'-methanimidoylbenzenecarboximidamide?
N-[(2E)-2-ethenylpenta-2,4-dienylidene]-N'-methanimidoylbenzenecarboximidamide has a molecular weight of 237.31 g/mol, XLogP of 3.41, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E)-2-ethenylpenta-2,4-dienylidene]-N'-methanimidoylbenzenecarboximidamide is sourced from PubChem (CID 166984457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).