C24H24N2O6S — CID 166985237
N-[2-(2,7-dioxocyclononyl)-1,3-dioxoisoindol-5-yl]-2-methylbenzenesulfonamide (PubChem CID 166985237) has the molecular formula C24H24N2O6S and a molecular weight of 468.53 g/mol. Its IUPAC name is N-[2-(2,7-dioxocyclononyl)-1,3-dioxoisoindol-5-yl]-2-methylbenzenesulfonamide.
| Compound Name | N-[2-(2,7-dioxocyclononyl)-1,3-dioxoisoindol-5-yl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 166985237 |
| Molecular Formula | C24H24N2O6S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | N-[2-(2,7-dioxocyclononyl)-1,3-dioxoisoindol-5-yl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccccc1S(=O)(=O)Nc1ccc2c(c1)C(=O)N(C1CCC(=O)CCCCC1=O)C2=O |
| InChI | InChI=1S/C24H24N2O6S/c1-15-6-2-5-9-22(15)33(31,32)25-16-10-12-18-19(14-16)24(30)26(23(18)29)20-13-11-17(27)7-3-4-8-21(20)28/h2,5-6,9-10,12,14,20,25H,3-4,7-8,11,13H2,1H3 |
| InChIKey | GWFPIQZDCNFMPE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|