C35H36BrN7O5 — CID 166994176
3-[6-[6-[4-[4-(8-bromoquinoxalin-2-yl)pyrazol-1-yl]piperidin-1-yl]-6-oxohexoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166994176) has the molecular formula C35H36BrN7O5 and a molecular weight of 714.62 g/mol. Its IUPAC name is 3-[6-[6-[4-[4-(8-bromoquinoxalin-2-yl)pyrazol-1-yl]piperidin-1-yl]-6-oxohexoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[6-[4-[4-(8-bromoquinoxalin-2-yl)pyrazol-1-yl]piperidin-1-yl]-6-oxohexoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166994176 |
| Molecular Formula | C35H36BrN7O5 |
| Molecular Weight | 714.62 g/mol |
| Exact Mass | 713.20 |
| IUPAC Name | 3-[6-[6-[4-[4-(8-bromoquinoxalin-2-yl)pyrazol-1-yl]piperidin-1-yl]-6-oxohexoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(OCCCCCC(=O)N4CCC(n5cc(-c6cnc7cccc(Br)c7n6)cn5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C35H36BrN7O5/c36-27-5-4-6-28-33(27)39-29(19-37-28)23-18-38-43(21-23)24-12-14-41(15-13-24)32(45)7-2-1-3-16-48-25-8-9-26-22(17-25)20-42(35(26)47)30-10-11-31(44)40-34(30)46/h4-6,8-9,17-19,21,24,30H,1-3,7,10-16,20H2,(H,40,44,46) |
| InChIKey | VJJSCBOCABFLSL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.62 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|