C35H41N7O5 — CID 166993797
3-[6-[6-[4-[[(E)-3-amino-2-quinoxalin-2-ylprop-1-enyl]amino]piperidin-1-yl]-6-oxohexoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166993797) has the molecular formula C35H41N7O5 and a molecular weight of 639.76 g/mol. Its IUPAC name is 3-[6-[6-[4-[[(E)-3-amino-2-quinoxalin-2-ylprop-1-enyl]amino]piperidin-1-yl]-6-oxohexoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[6-[4-[[(E)-3-amino-2-quinoxalin-2-ylprop-1-enyl]amino]piperidin-1-yl]-6-oxohexoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166993797 |
| Molecular Formula | C35H41N7O5 |
| Molecular Weight | 639.76 g/mol |
| Exact Mass | 639.32 |
| IUPAC Name | 3-[6-[6-[4-[[(E)-3-amino-2-quinoxalin-2-ylprop-1-enyl]amino]piperidin-1-yl]-6-oxohexoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | NC/C(=C\NC1CCN(C(=O)CCCCCOc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)CC1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C35H41N7O5/c36-19-24(30-21-38-28-6-3-4-7-29(28)39-30)20-37-25-13-15-41(16-14-25)33(44)8-2-1-5-17-47-26-9-10-27-23(18-26)22-42(35(27)46)31-11-12-32(43)40-34(31)45/h3-4,6-7,9-10,18,20-21,25,31,37H,1-2,5,8,11-17,19,22,36H2,(H,40,43,45)/b24-20+ |
| InChIKey | ICSNUNKGVRKPFR-HIXSDJFHSA-N |
| XLogP | 2.91 |
| TPSA | 159.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.76 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|