C12H22N2 — CID 167001296
2-methyl-N'-[(1Z,3E)-3-methylhepta-1,3-dienyl]propanimidamide (PubChem CID 167001296) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 2-methyl-N'-[(1Z,3E)-3-methylhepta-1,3-dienyl]propanimidamide.
| Compound Name | 2-methyl-N'-[(1Z,3E)-3-methylhepta-1,3-dienyl]propanimidamide |
|---|---|
| PubChem CID | 167001296 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 2-methyl-N'-[(1Z,3E)-3-methylhepta-1,3-dienyl]propanimidamide |
| SMILES | CCC/C=C(C)/C=C\N=C(/N)C(C)C |
| InChI | InChI=1S/C12H22N2/c1-5-6-7-11(4)8-9-14-12(13)10(2)3/h7-10H,5-6H2,1-4H3,(H2,13,14)/b9-8-,11-7+ |
| InChIKey | ISRLNRJGECGHES-NVKZJLNYSA-N |
| XLogP | 3.26 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|