C13H18FN3 — CID 164589470
(1Z)-2-ethenyl-1-[(4Z,6E)-4-ethenyl-6-fluoroocta-4,6-dienylidene]guanidine (PubChem CID 164589470) has the molecular formula C13H18FN3 and a molecular weight of 235.31 g/mol. Its IUPAC name is (1Z)-2-ethenyl-1-[(4Z,6E)-4-ethenyl-6-fluoroocta-4,6-dienylidene]guanidine.
| Compound Name | (1Z)-2-ethenyl-1-[(4Z,6E)-4-ethenyl-6-fluoroocta-4,6-dienylidene]guanidine |
|---|---|
| PubChem CID | 164589470 |
| Molecular Formula | C13H18FN3 |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | (1Z)-2-ethenyl-1-[(4Z,6E)-4-ethenyl-6-fluoroocta-4,6-dienylidene]guanidine |
| SMILES | C=C/N=C(N)/N=C\CC/C(C=C)=C/C(F)=C\C |
| InChI | InChI=1S/C13H18FN3/c1-4-11(10-12(14)5-2)8-7-9-17-13(15)16-6-3/h4-6,9-10H,1,3,7-8H2,2H3,(H2,15,16)/b11-10+,12-5+,17-9- |
| InChIKey | LOCYKNCADYNGLX-OEJMZFOLSA-N |
| XLogP | 3.28 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|