C25H35N3OS — CID 167016909
N-(2-cyanododec-1-en-4-yl)-3-(6-ethyl-1,3-benzothiazol-2-yl)propanamide (PubChem CID 167016909) has the molecular formula C25H35N3OS and a molecular weight of 425.64 g/mol. Its IUPAC name is N-(2-cyanododec-1-en-4-yl)-3-(6-ethyl-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | N-(2-cyanododec-1-en-4-yl)-3-(6-ethyl-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 167016909 |
| Molecular Formula | C25H35N3OS |
| Molecular Weight | 425.64 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | N-(2-cyanododec-1-en-4-yl)-3-(6-ethyl-1,3-benzothiazol-2-yl)propanamide |
| SMILES | C=C(C#N)CC(CCCCCCCC)NC(=O)CCc1nc2ccc(CC)cc2s1 |
| InChI | InChI=1S/C25H35N3OS/c1-4-6-7-8-9-10-11-21(16-19(3)18-26)27-24(29)14-15-25-28-22-13-12-20(5-2)17-23(22)30-25/h12-13,17,21H,3-11,14-16H2,1-2H3,(H,27,29) |
| InChIKey | HKCRWJNKKQTCNN-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.64 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|