C10H15FN2O — CID 167023175
cis-(1S,2S)-N-(C-ethenyl-N-propan-2-ylcarbonimidoyl)-2-fluorocyclopropane-1-carboxamide (PubChem CID 167023175) has the molecular formula C10H15FN2O and a molecular weight of 198.24 g/mol. Its IUPAC name is cis-(1S,2S)-N-(C-ethenyl-N-propan-2-ylcarbonimidoyl)-2-fluorocyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2S)-N-(C-ethenyl-N-propan-2-ylcarbonimidoyl)-2-fluorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 167023175 |
| Molecular Formula | C10H15FN2O |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | cis-(1S,2S)-N-(C-ethenyl-N-propan-2-ylcarbonimidoyl)-2-fluorocyclopropane-1-carboxamide |
| SMILES | C=C/C(=N\C(C)C)NC(=O)[C@@H]1C[C@@H]1F |
| InChI | InChI=1S/C10H15FN2O/c1-4-9(12-6(2)3)13-10(14)7-5-8(7)11/h4,6-8H,1,5H2,2-3H3,(H,12,13,14)/t7-,8+/m1/s1 |
| InChIKey | NGVQJFYGBXCSMR-SFYZADRCSA-N |
| XLogP | 1.45 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|