C18H25ClN4O2S — CID 167024149
2-chloro-2'-(3-methoxy-1-methylpyrazol-4-yl)-6'-methylspiro[4,5,7,8-tetrahydrothieno[2,3-e]oxazocine-9,4'-piperidine] (PubChem CID 167024149) has the molecular formula C18H25ClN4O2S and a molecular weight of 396.94 g/mol. Its IUPAC name is 2-chloro-2'-(3-methoxy-1-methylpyrazol-4-yl)-6'-methylspiro[4,5,7,8-tetrahydrothieno[2,3-e]oxazocine-9,4'-piperidine].
| Compound Name | 2-chloro-2'-(3-methoxy-1-methylpyrazol-4-yl)-6'-methylspiro[4,5,7,8-tetrahydrothieno[2,3-e]oxazocine-9,4'-piperidine] |
|---|---|
| PubChem CID | 167024149 |
| Molecular Formula | C18H25ClN4O2S |
| Molecular Weight | 396.94 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 2-chloro-2'-(3-methoxy-1-methylpyrazol-4-yl)-6'-methylspiro[4,5,7,8-tetrahydrothieno[2,3-e]oxazocine-9,4'-piperidine] |
| SMILES | COc1nn(C)cc1C1CC2(CNOCCc3cc(Cl)sc32)CC(C)N1 |
| InChI | InChI=1S/C18H25ClN4O2S/c1-11-7-18(8-14(21-11)13-9-23(2)22-17(13)24-3)10-20-25-5-4-12-6-15(19)26-16(12)18/h6,9,11,14,20-21H,4-5,7-8,10H2,1-3H3 |
| InChIKey | KWZFRKFRRCGCIV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 60.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.94 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |