C19H24ClN3OS — CID 167024424
2-chloro-2'-methyl-6'-(6-methyl-3-pyridinyl)spiro[4,5,7,8-tetrahydrothieno[2,3-e]oxazocine-9,4'-piperidine] (PubChem CID 167024424) has the molecular formula C19H24ClN3OS and a molecular weight of 377.94 g/mol. Its IUPAC name is 2-chloro-2'-methyl-6'-(6-methyl-3-pyridinyl)spiro[4,5,7,8-tetrahydrothieno[2,3-e]oxazocine-9,4'-piperidine].
| Compound Name | 2-chloro-2'-methyl-6'-(6-methyl-3-pyridinyl)spiro[4,5,7,8-tetrahydrothieno[2,3-e]oxazocine-9,4'-piperidine] |
|---|---|
| PubChem CID | 167024424 |
| Molecular Formula | C19H24ClN3OS |
| Molecular Weight | 377.94 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 2-chloro-2'-methyl-6'-(6-methyl-3-pyridinyl)spiro[4,5,7,8-tetrahydrothieno[2,3-e]oxazocine-9,4'-piperidine] |
| SMILES | Cc1ccc(C2CC3(CNOCCc4cc(Cl)sc43)CC(C)N2)cn1 |
| InChI | InChI=1S/C19H24ClN3OS/c1-12-3-4-15(10-21-12)16-9-19(8-13(2)23-16)11-22-24-6-5-14-7-17(20)25-18(14)19/h3-4,7,10,13,16,22-23H,5-6,8-9,11H2,1-2H3 |
| InChIKey | GMHUSLAQDMSLMJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.94 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |